C20H25F5O3 — CID 18650596
[4-(1,1,2,2,2-pentafluoroethoxy)phenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 18650596) has the molecular formula C20H25F5O3 and a molecular weight of 408.41 g/mol. Its IUPAC name is [4-(1,1,2,2,2-pentafluoroethoxy)phenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [4-(1,1,2,2,2-pentafluoroethoxy)phenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18650596 |
| Molecular Formula | C20H25F5O3 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [4-(1,1,2,2,2-pentafluoroethoxy)phenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(OC(F)(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H25F5O3/c1-2-3-4-5-14-6-8-15(9-7-14)18(26)27-16-10-12-17(13-11-16)28-20(24,25)19(21,22)23/h10-15H,2-9H2,1H3 |
| InChIKey | XWSGXFOFQGMGLI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|