C27H37F3O3 — CID 20717287
[4-(trifluoromethoxy)phenyl] 4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexane-1-carboxylate (PubChem CID 20717287) has the molecular formula C27H37F3O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexane-1-carboxylate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20717287 |
| Molecular Formula | C27H37F3O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 4-[(E)-2-(4-pentylcyclohexyl)ethenyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(/C=C/C2CCC(C(=O)Oc3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H37F3O3/c1-2-3-4-5-20-6-8-21(9-7-20)10-11-22-12-14-23(15-13-22)26(31)32-24-16-18-25(19-17-24)33-27(28,29)30/h10-11,16-23H,2-9,12-15H2,1H3/b11-10+ |
| InChIKey | GBHFOZFNTURKRB-ZHACJKMWSA-N |
| XLogP | 8.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|