C22H27F3O — CID 18657404
1-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene (PubChem CID 18657404) has the molecular formula C22H27F3O and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene.
| Compound Name | 1-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 18657404 |
| Molecular Formula | C22H27F3O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[(E)-4-(4-pentylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene |
| SMILES | CCCCCC1CCC(/C=C/C#Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H27F3O/c1-2-3-4-7-18-10-12-19(13-11-18)8-5-6-9-20-14-16-21(17-15-20)26-22(23,24)25/h5,8,14-19H,2-4,7,10-13H2,1H3/b8-5+ |
| InChIKey | DGMXEJUTMAPTBR-VMPITWQZSA-N |
| XLogP | 6.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|