C25H31F3O — CID 54336754
1-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene (PubChem CID 54336754) has the molecular formula C25H31F3O and a molecular weight of 404.52 g/mol. Its IUPAC name is 1-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene.
| Compound Name | 1-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54336754 |
| Molecular Formula | C25H31F3O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene |
| SMILES | CCC1CCC(C2CCC(C=CC#Cc3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H31F3O/c1-2-19-7-13-22(14-8-19)23-15-9-20(10-16-23)5-3-4-6-21-11-17-24(18-12-21)29-25(26,27)28/h3,5,11-12,17-20,22-23H,2,7-10,13-16H2,1H3 |
| InChIKey | TWAAQTMXKMIJLG-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|