C25H30FN — CID 54375801
4-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-2-fluorobenzonitrile (PubChem CID 54375801) has the molecular formula C25H30FN and a molecular weight of 363.52 g/mol. Its IUPAC name is 4-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-2-fluorobenzonitrile.
| Compound Name | 4-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 54375801 |
| Molecular Formula | C25H30FN |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-[4-[4-(4-ethylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]-2-fluorobenzonitrile |
| SMILES | CCC1CCC(C2CCC(C=CC#Cc3ccc(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H30FN/c1-2-19-7-12-22(13-8-19)23-14-9-20(10-15-23)5-3-4-6-21-11-16-24(18-27)25(26)17-21/h3,5,11,16-17,19-20,22-23H,2,7-10,12-15H2,1H3 |
| InChIKey | UWKHWJKDXCABOT-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|