C28H30FN — CID 18657103
2-fluoro-4-[(E)-4-[4-(4-pentylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile (PubChem CID 18657103) has the molecular formula C28H30FN and a molecular weight of 399.55 g/mol. Its IUPAC name is 2-fluoro-4-[(E)-4-[4-(4-pentylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile.
| Compound Name | 2-fluoro-4-[(E)-4-[4-(4-pentylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile |
|---|---|
| PubChem CID | 18657103 |
| Molecular Formula | C28H30FN |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 2-fluoro-4-[(E)-4-[4-(4-pentylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile |
| SMILES | CCCCCc1ccc(C2CCC(/C=C/C#Cc3ccc(C#N)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C28H30FN/c1-2-3-4-7-22-10-15-25(16-11-22)26-17-12-23(13-18-26)8-5-6-9-24-14-19-27(21-30)28(29)20-24/h5,8,10-11,14-16,19-20,23,26H,2-4,7,12-13,17-18H2,1H3/b8-5+ |
| InChIKey | SISQBJVQHBUOFS-VMPITWQZSA-N |
| XLogP | 7.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|