C20H27N — CID 19613186
(E)-3-[4-(4-pentylphenyl)cyclohexyl]prop-2-enenitrile (PubChem CID 19613186) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is (E)-3-[4-(4-pentylphenyl)cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-(4-pentylphenyl)cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19613186 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (E)-3-[4-(4-pentylphenyl)cyclohexyl]prop-2-enenitrile |
| SMILES | CCCCCc1ccc(C2CCC(/C=C/C#N)CC2)cc1 |
| InChI | InChI=1S/C20H27N/c1-2-3-4-6-17-8-12-19(13-9-17)20-14-10-18(11-15-20)7-5-16-21/h5,7-9,12-13,18,20H,2-4,6,10-11,14-15H2,1H3/b7-5+ |
| InChIKey | YDBFFAVVWSTGMI-FNORWQNLSA-N |
| XLogP | 5.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|