C24H33N — CID 19612816
(E)-3-[4-[4-(4-propylphenyl)cyclohexyl]cyclohexyl]prop-2-enenitrile (PubChem CID 19612816) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is (E)-3-[4-[4-(4-propylphenyl)cyclohexyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[4-(4-propylphenyl)cyclohexyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 19612816 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (E)-3-[4-[4-(4-propylphenyl)cyclohexyl]cyclohexyl]prop-2-enenitrile |
| SMILES | CCCc1ccc(C2CCC(C3CCC(/C=C/C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H33N/c1-2-4-19-6-10-21(11-7-19)23-14-16-24(17-15-23)22-12-8-20(9-13-22)5-3-18-25/h3,5-7,10-11,20,22-24H,2,4,8-9,12-17H2,1H3/b5-3+ |
| InChIKey | JJHIXYATIPJSHB-HWKANZROSA-N |
| XLogP | 6.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|