C23H33Br — CID 18656236
1-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]-4-propylbenzene (PubChem CID 18656236) has the molecular formula C23H33Br and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]-4-propylbenzene.
| Compound Name | 1-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]-4-propylbenzene |
|---|---|
| PubChem CID | 18656236 |
| Molecular Formula | C23H33Br |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]-4-propylbenzene |
| SMILES | CCCc1ccc(C2CCC(C3CCC(/C=C/Br)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H33Br/c1-2-3-18-4-8-20(9-5-18)22-12-14-23(15-13-22)21-10-6-19(7-11-21)16-17-24/h4-5,8-9,16-17,19,21-23H,2-3,6-7,10-15H2,1H3/b17-16+ |
| InChIKey | PGRXTMZQMPWNBX-WUKNDPDISA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |