C22H31F — CID 19798836
1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 19798836) has the molecular formula C22H31F and a molecular weight of 314.49 g/mol. Its IUPAC name is 1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19798836 |
| Molecular Formula | C22H31F |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | CCc1ccc(C2CCC(C3CCC(/C=C/F)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H31F/c1-2-17-3-7-19(8-4-17)21-11-13-22(14-12-21)20-9-5-18(6-10-20)15-16-23/h3-4,7-8,15-16,18,20-22H,2,5-6,9-14H2,1H3/b16-15+ |
| InChIKey | XYTSOOXMGMTAIN-FOCLMDBBSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |