C22H25F — CID 19780938
1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]phenyl]benzene (PubChem CID 19780938) has the molecular formula C22H25F and a molecular weight of 308.44 g/mol. Its IUPAC name is 1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]phenyl]benzene.
| Compound Name | 1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 19780938 |
| Molecular Formula | C22H25F |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-ethyl-4-[4-[4-[(E)-2-fluoroethenyl]cyclohexyl]phenyl]benzene |
| SMILES | CCc1ccc(-c2ccc(C3CCC(/C=C/F)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H25F/c1-2-17-3-7-19(8-4-17)21-11-13-22(14-12-21)20-9-5-18(6-10-20)15-16-23/h3-4,7-8,11-16,18,20H,2,5-6,9-10H2,1H3/b16-15+ |
| InChIKey | HFRDOFSTGIQMEO-FOCLMDBBSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |