C19H27F — CID 19798701
1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-pentylbenzene (PubChem CID 19798701) has the molecular formula C19H27F and a molecular weight of 274.42 g/mol. Its IUPAC name is 1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-pentylbenzene.
| Compound Name | 1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-pentylbenzene |
|---|---|
| PubChem CID | 19798701 |
| Molecular Formula | C19H27F |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 1-[4-[(E)-2-fluoroethenyl]cyclohexyl]-4-pentylbenzene |
| SMILES | CCCCCc1ccc(C2CCC(/C=C/F)CC2)cc1 |
| InChI | InChI=1S/C19H27F/c1-2-3-4-5-16-6-10-18(11-7-16)19-12-8-17(9-13-19)14-15-20/h6-7,10-11,14-15,17,19H,2-5,8-9,12-13H2,1H3/b15-14+ |
| InChIKey | LNJXSHBBAZFRIJ-CCEZHUSRSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|