C18H25F — CID 19798870
1-butyl-4-[4-[(E)-2-fluoroethenyl]cyclohexyl]benzene (PubChem CID 19798870) has the molecular formula C18H25F and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-butyl-4-[4-[(E)-2-fluoroethenyl]cyclohexyl]benzene.
| Compound Name | 1-butyl-4-[4-[(E)-2-fluoroethenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19798870 |
| Molecular Formula | C18H25F |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-butyl-4-[4-[(E)-2-fluoroethenyl]cyclohexyl]benzene |
| SMILES | CCCCc1ccc(C2CCC(/C=C/F)CC2)cc1 |
| InChI | InChI=1S/C18H25F/c1-2-3-4-15-5-9-17(10-6-15)18-11-7-16(8-12-18)13-14-19/h5-6,9-10,13-14,16,18H,2-4,7-8,11-12H2,1H3/b14-13+ |
| InChIKey | NWSNRDWIFVPSGN-BUHFOSPRSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |