C25H32FN — CID 54411037
3-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoroprop-2-enenitrile (PubChem CID 54411037) has the molecular formula C25H32FN and a molecular weight of 365.54 g/mol. Its IUPAC name is 3-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoroprop-2-enenitrile.
| Compound Name | 3-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoroprop-2-enenitrile |
|---|---|
| PubChem CID | 54411037 |
| Molecular Formula | C25H32FN |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 3-[4-[2-[4-(4-ethylphenyl)cyclohexyl]ethenyl]cyclohexyl]-2-fluoroprop-2-enenitrile |
| SMILES | CCc1ccc(C2CCC(C=CC3CCC(C=C(F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H32FN/c1-2-19-9-13-23(14-10-19)24-15-11-21(12-16-24)4-3-20-5-7-22(8-6-20)17-25(26)18-27/h3-4,9-10,13-14,17,20-22,24H,2,5-8,11-12,15-16H2,1H3 |
| InChIKey | VUDPENSJLCHIKT-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|