C26H34FNO2 — CID 54478833
[4-(2-cyano-2-fluoroethenyl)cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate (PubChem CID 54478833) has the molecular formula C26H34FNO2 and a molecular weight of 411.56 g/mol. Its IUPAC name is [4-(2-cyano-2-fluoroethenyl)cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(2-cyano-2-fluoroethenyl)cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54478833 |
| Molecular Formula | C26H34FNO2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | [4-(2-cyano-2-fluoroethenyl)cyclohexyl] 4-(4-butylphenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCc1ccc(C2CCC(C(=O)OC3CCC(C=C(F)C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H34FNO2/c1-2-3-4-19-5-9-21(10-6-19)22-11-13-23(14-12-22)26(29)30-25-15-7-20(8-16-25)17-24(27)18-28/h5-6,9-10,17,20,22-23,25H,2-4,7-8,11-16H2,1H3 |
| InChIKey | XNOAVINHEICGOF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|