C30H43NO2 — CID 18394129
[4-(4-hexylphenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate (PubChem CID 18394129) has the molecular formula C30H43NO2 and a molecular weight of 449.68 g/mol. Its IUPAC name is [4-(4-hexylphenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate.
| Compound Name | [4-(4-hexylphenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18394129 |
| Molecular Formula | C30H43NO2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | [4-(4-hexylphenyl)cyclohexyl] 4-[(E)-4-cyanobut-3-enyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCCc1ccc(C2CCC(OC(=O)C3CCC(CC/C=C/C#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H43NO2/c1-2-3-4-6-9-24-11-15-26(16-12-24)27-19-21-29(22-20-27)33-30(32)28-17-13-25(14-18-28)10-7-5-8-23-31/h5,8,11-12,15-16,25,27-29H,2-4,6-7,9-10,13-14,17-22H2,1H3/b8-5+ |
| InChIKey | OXBGFEXYPFJUET-VMPITWQZSA-N |
| XLogP | 8.05 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|