C28H39N — CID 19612897
(E)-5-[4-[1-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile (PubChem CID 19612897) has the molecular formula C28H39N and a molecular weight of 389.63 g/mol. Its IUPAC name is (E)-5-[4-[1-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile.
| Compound Name | (E)-5-[4-[1-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 19612897 |
| Molecular Formula | C28H39N |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | (E)-5-[4-[1-[4-(4-propylphenyl)cyclohexyl]ethenyl]cyclohexyl]pent-2-enenitrile |
| SMILES | C=C(C1CCC(CC/C=C/C#N)CC1)C1CCC(c2ccc(CCC)cc2)CC1 |
| InChI | InChI=1S/C28H39N/c1-3-7-23-11-15-27(16-12-23)28-19-17-26(18-20-28)22(2)25-13-9-24(10-14-25)8-5-4-6-21-29/h4,6,11-12,15-16,24-26,28H,2-3,5,7-10,13-14,17-20H2,1H3/b6-4+ |
| InChIKey | JHKLOFUDCKARQB-GQCTYLIASA-N |
| XLogP | 8.14 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|