C21H30 — CID 54018435
1-(4-hexa-3,5-dienylcyclohexyl)-4-propylbenzene (PubChem CID 54018435) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-(4-hexa-3,5-dienylcyclohexyl)-4-propylbenzene.
| Compound Name | 1-(4-hexa-3,5-dienylcyclohexyl)-4-propylbenzene |
|---|---|
| PubChem CID | 54018435 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-(4-hexa-3,5-dienylcyclohexyl)-4-propylbenzene |
| SMILES | C=CC=CCCC1CCC(c2ccc(CCC)cc2)CC1 |
| InChI | InChI=1S/C21H30/c1-3-5-6-7-9-19-12-16-21(17-13-19)20-14-10-18(8-4-2)11-15-20/h3,5-6,10-11,14-15,19,21H,1,4,7-9,12-13,16-17H2,2H3 |
| InChIKey | KXGBGCUQENNADM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|