C19H27F — CID 54484505
1-[4-(4-fluorobut-3-enyl)cyclohexyl]-4-propylbenzene (PubChem CID 54484505) has the molecular formula C19H27F and a molecular weight of 274.42 g/mol. Its IUPAC name is 1-[4-(4-fluorobut-3-enyl)cyclohexyl]-4-propylbenzene.
| Compound Name | 1-[4-(4-fluorobut-3-enyl)cyclohexyl]-4-propylbenzene |
|---|---|
| PubChem CID | 54484505 |
| Molecular Formula | C19H27F |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 1-[4-(4-fluorobut-3-enyl)cyclohexyl]-4-propylbenzene |
| SMILES | CCCc1ccc(C2CCC(CCC=CF)CC2)cc1 |
| InChI | InChI=1S/C19H27F/c1-2-5-16-7-11-18(12-8-16)19-13-9-17(10-14-19)6-3-4-15-20/h4,7-8,11-12,15,17,19H,2-3,5-6,9-10,13-14H2,1H3 |
| InChIKey | XRIXNPXOJSEDBT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |