C21H31F — CID 19798745
1-[(E)-4-fluorobut-3-enyl]-4-[2-(4-propylcyclohexyl)ethyl]benzene (PubChem CID 19798745) has the molecular formula C21H31F and a molecular weight of 302.48 g/mol. Its IUPAC name is 1-[(E)-4-fluorobut-3-enyl]-4-[2-(4-propylcyclohexyl)ethyl]benzene.
| Compound Name | 1-[(E)-4-fluorobut-3-enyl]-4-[2-(4-propylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 19798745 |
| Molecular Formula | C21H31F |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-[(E)-4-fluorobut-3-enyl]-4-[2-(4-propylcyclohexyl)ethyl]benzene |
| SMILES | CCCC1CCC(CCc2ccc(CC/C=C/F)cc2)CC1 |
| InChI | InChI=1S/C21H31F/c1-2-5-18-7-11-20(12-8-18)15-16-21-13-9-19(10-14-21)6-3-4-17-22/h4,9-10,13-14,17-18,20H,2-3,5-8,11-12,15-16H2,1H3/b17-4+ |
| InChIKey | FUYLQKCIRDJBNC-HAVNEIBRSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |