C19H27FO — CID 19781025
1-[(E)-3-fluoroprop-2-enyl]-4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]benzene (PubChem CID 19781025) has the molecular formula C19H27FO and a molecular weight of 290.42 g/mol. Its IUPAC name is 1-[(E)-3-fluoroprop-2-enyl]-4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]benzene.
| Compound Name | 1-[(E)-3-fluoroprop-2-enyl]-4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 19781025 |
| Molecular Formula | C19H27FO |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-[(E)-3-fluoroprop-2-enyl]-4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]benzene |
| SMILES | COCC1CCC(CCc2ccc(C/C=C/F)cc2)CC1 |
| InChI | InChI=1S/C19H27FO/c1-21-15-19-12-10-18(11-13-19)9-8-17-6-4-16(5-7-17)3-2-14-20/h2,4-7,14,18-19H,3,8-13,15H2,1H3/b14-2+ |
| InChIKey | QWZUIIUZOFDSAZ-JLZUIIAYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |