C25H26F8O2 — CID 22080411
1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]phenyl]benzene (PubChem CID 22080411) has the molecular formula C25H26F8O2 and a molecular weight of 510.47 g/mol. Its IUPAC name is 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]phenyl]benzene.
| Compound Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 22080411 |
| Molecular Formula | C25H26F8O2 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 1,3-difluoro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-[4-[2-[4-(methoxymethyl)cyclohexyl]ethyl]phenyl]benzene |
| SMILES | COCC1CCC(CCc2ccc(-c3cc(F)c(OC(F)(F)C(F)C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H26F8O2/c1-34-14-17-6-4-15(5-7-17)2-3-16-8-10-18(11-9-16)19-12-20(26)22(21(27)13-19)35-25(32,33)23(28)24(29,30)31/h8-13,15,17,23H,2-7,14H2,1H3 |
| InChIKey | HIYPCWGLUNZUNG-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |