C25H34F6O3 — CID 22080262
1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]ethyl]benzene (PubChem CID 22080262) has the molecular formula C25H34F6O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]ethyl]benzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 22080262 |
| Molecular Formula | C25H34F6O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-[4-(methoxymethoxy)cyclohexyl]cyclohexyl]ethyl]benzene |
| SMILES | COCOC1CCC(C2CCC(CCc3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H34F6O3/c1-32-16-33-21-14-10-20(11-15-21)19-8-4-17(5-9-19)2-3-18-6-12-22(13-7-18)34-25(30,31)23(26)24(27,28)29/h6-7,12-13,17,19-21,23H,2-5,8-11,14-16H2,1H3 |
| InChIKey | GDNMHFVJUWEGLD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|