C25H32F6O — CID 22080366
1-[(E)-2-[4-(4-ethylcyclohexyl)cyclohexyl]ethenyl]-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene (PubChem CID 22080366) has the molecular formula C25H32F6O and a molecular weight of 462.52 g/mol. Its IUPAC name is 1-[(E)-2-[4-(4-ethylcyclohexyl)cyclohexyl]ethenyl]-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene.
| Compound Name | 1-[(E)-2-[4-(4-ethylcyclohexyl)cyclohexyl]ethenyl]-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
|---|---|
| PubChem CID | 22080366 |
| Molecular Formula | C25H32F6O |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 1-[(E)-2-[4-(4-ethylcyclohexyl)cyclohexyl]ethenyl]-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
| SMILES | CCC1CCC(C2CCC(/C=C/c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H32F6O/c1-2-17-5-11-20(12-6-17)21-13-7-18(8-14-21)3-4-19-9-15-22(16-10-19)32-25(30,31)23(26)24(27,28)29/h3-4,9-10,15-18,20-21,23H,2,5-8,11-14H2,1H3/b4-3+ |
| InChIKey | SSBBCQDBRFVGQS-ONEGZZNKSA-N |
| XLogP | 8.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |