C26H22F6O — CID 54297932
1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene (PubChem CID 54297932) has the molecular formula C26H22F6O and a molecular weight of 464.45 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 54297932 |
| Molecular Formula | C26H22F6O |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene |
| SMILES | CCCc1ccc(-c2ccc(C=Cc3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H22F6O/c1-2-3-18-6-12-21(13-7-18)22-14-8-19(9-15-22)4-5-20-10-16-23(17-11-20)33-26(31,32)24(27)25(28,29)30/h4-17,24H,2-3H2,1H3 |
| InChIKey | SCCAMERXLLROOZ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|