C28H32F6O — CID 54259192
1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-pentylphenyl)cyclohexyl]ethenyl]benzene (PubChem CID 54259192) has the molecular formula C28H32F6O and a molecular weight of 498.55 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-pentylphenyl)cyclohexyl]ethenyl]benzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-pentylphenyl)cyclohexyl]ethenyl]benzene |
|---|---|
| PubChem CID | 54259192 |
| Molecular Formula | C28H32F6O |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[2-[4-(4-pentylphenyl)cyclohexyl]ethenyl]benzene |
| SMILES | CCCCCc1ccc(C2CCC(C=Cc3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H32F6O/c1-2-3-4-5-20-8-14-23(15-9-20)24-16-10-21(11-17-24)6-7-22-12-18-25(19-13-22)35-28(33,34)26(29)27(30,31)32/h6-9,12-15,18-19,21,24,26H,2-5,10-11,16-17H2,1H3 |
| InChIKey | RCGPLJZYPSTZKV-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|