C28H32F4O — CID 19810267
1-hexyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene (PubChem CID 19810267) has the molecular formula C28H32F4O and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-hexyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene.
| Compound Name | 1-hexyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19810267 |
| Molecular Formula | C28H32F4O |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 1-hexyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene |
| SMILES | CCCCCCc1ccc(C2CCC(C#Cc3ccc(OC(F)(F)C(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H32F4O/c1-2-3-4-5-6-21-9-15-24(16-10-21)25-17-11-22(12-18-25)7-8-23-13-19-26(20-14-23)33-28(31,32)27(29)30/h9-10,13-16,19-20,22,25,27H,2-6,11-12,17-18H2,1H3 |
| InChIKey | HLLHKZDUIITQML-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|