C26H28F4O — CID 19810301
1-butyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene (PubChem CID 19810301) has the molecular formula C26H28F4O and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-butyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene.
| Compound Name | 1-butyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19810301 |
| Molecular Formula | C26H28F4O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-butyl-4-[4-[2-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethynyl]cyclohexyl]benzene |
| SMILES | CCCCc1ccc(C2CCC(C#Cc3ccc(OC(F)(F)C(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H28F4O/c1-2-3-4-19-7-13-22(14-8-19)23-15-9-20(10-16-23)5-6-21-11-17-24(18-12-21)31-26(29,30)25(27)28/h7-8,11-14,17-18,20,23,25H,2-4,9-10,15-16H2,1H3 |
| InChIKey | POCADLGAHHEONO-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|