C29H36F6O — CID 22080212
1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]benzene (PubChem CID 22080212) has the molecular formula C29H36F6O and a molecular weight of 514.59 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]benzene.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 22080212 |
| Molecular Formula | C29H36F6O |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropoxy)-4-[4-[2-(4-hexylcyclohexyl)ethyl]phenyl]benzene |
| SMILES | CCCCCCC1CCC(CCc2ccc(-c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H36F6O/c1-2-3-4-5-6-21-7-9-22(10-8-21)11-12-23-13-15-24(16-14-23)25-17-19-26(20-18-25)36-29(34,35)27(30)28(31,32)33/h13-22,27H,2-12H2,1H3 |
| InChIKey | CFRQETCYAPJHMH-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|