C27H29F7O3 — CID 22080091
(4-pentylcyclohexyl) 3-fluoro-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoate (PubChem CID 22080091) has the molecular formula C27H29F7O3 and a molecular weight of 534.51 g/mol. Its IUPAC name is (4-pentylcyclohexyl) 3-fluoro-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoate.
| Compound Name | (4-pentylcyclohexyl) 3-fluoro-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 22080091 |
| Molecular Formula | C27H29F7O3 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | (4-pentylcyclohexyl) 3-fluoro-4-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]benzoate |
| SMILES | CCCCCC1CCC(OC(=O)c2ccc(-c3ccc(OC(F)(F)C(F)C(F)(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H29F7O3/c1-2-3-4-5-17-6-11-20(12-7-17)36-24(35)19-10-15-22(23(28)16-19)18-8-13-21(14-9-18)37-27(33,34)25(29)26(30,31)32/h8-10,13-17,20,25H,2-7,11-12H2,1H3 |
| InChIKey | SPOKYAIIYOALBP-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|