C36H38F8O4 — CID 169018231
[(2S)-1,1,1-trifluorooctan-2-yl] 3-fluoro-4-[4-[2-fluoro-4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl]phenyl]benzoate (PubChem CID 169018231) has the molecular formula C36H38F8O4 and a molecular weight of 686.68 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorooctan-2-yl] 3-fluoro-4-[4-[2-fluoro-4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl]phenyl]benzoate.
| Compound Name | [(2S)-1,1,1-trifluorooctan-2-yl] 3-fluoro-4-[4-[2-fluoro-4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 169018231 |
| Molecular Formula | C36H38F8O4 |
| Molecular Weight | 686.68 g/mol |
| Exact Mass | 686.26 |
| IUPAC Name | [(2S)-1,1,1-trifluorooctan-2-yl] 3-fluoro-4-[4-[2-fluoro-4-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl]phenyl]benzoate |
| SMILES | CCCCCC[C@H](OC(=O)c1ccc(-c2ccc(-c3ccc(C(=O)O[C@@H](CCCCCC)C(F)(F)F)cc3F)cc2)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C36H38F8O4/c1-3-5-7-9-11-31(35(39,40)41)47-33(45)25-17-19-27(29(37)21-25)23-13-15-24(16-14-23)28-20-18-26(22-30(28)38)34(46)48-32(36(42,43)44)12-10-8-6-4-2/h13-22,31-32H,3-12H2,1-2H3/t31-,32-/m0/s1 |
| InChIKey | YANKTCUQWPNMRQ-ACHIHNKUSA-N |
| XLogP | 11.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.68 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|