C15H18F3NO4 — CID 15219530
1,1,1-trifluorooctan-2-yl 4-nitrobenzoate (PubChem CID 15219530) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 4-nitrobenzoate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 4-nitrobenzoate |
|---|---|
| PubChem CID | 15219530 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 4-nitrobenzoate |
| SMILES | CCCCCCC(OC(=O)c1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO4/c1-2-3-4-5-6-13(15(16,17)18)23-14(20)11-7-9-12(10-8-11)19(21)22/h7-10,13H,2-6H2,1H3 |
| InChIKey | RINCVTXZFGVFLP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|