C32H39F3N4O4 — CID 170080534
[(2R)-octan-2-yl] 2-[4-[5-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylpyrimidin-2-yl]phenyl]pyrimidine-5-carboxylate (PubChem CID 170080534) has the molecular formula C32H39F3N4O4 and a molecular weight of 600.68 g/mol. Its IUPAC name is [(2R)-octan-2-yl] 2-[4-[5-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylpyrimidin-2-yl]phenyl]pyrimidine-5-carboxylate.
| Compound Name | [(2R)-octan-2-yl] 2-[4-[5-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylpyrimidin-2-yl]phenyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 170080534 |
| Molecular Formula | C32H39F3N4O4 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | [(2R)-octan-2-yl] 2-[4-[5-[(2S)-1,1,1-trifluorooctan-2-yl]oxycarbonylpyrimidin-2-yl]phenyl]pyrimidine-5-carboxylate |
| SMILES | CCCCCC[C@@H](C)OC(=O)c1cnc(-c2ccc(-c3ncc(C(=O)O[C@@H](CCCCCC)C(F)(F)F)cn3)cc2)nc1 |
| InChI | InChI=1S/C32H39F3N4O4/c1-4-6-8-10-12-22(3)42-30(40)25-18-36-28(37-19-25)23-14-16-24(17-15-23)29-38-20-26(21-39-29)31(41)43-27(32(33,34)35)13-11-9-7-5-2/h14-22,27H,4-13H2,1-3H3/t22-,27+/m1/s1 |
| InChIKey | AMYJUPXRRLYUCD-AMGIVPHBSA-N |
| XLogP | 8.17 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|