C25H33F3N2O3 — CID 22913215
(3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-(4-nonylphenyl)pyrimidine-5-carboxylate (PubChem CID 22913215) has the molecular formula C25H33F3N2O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is (3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-(4-nonylphenyl)pyrimidine-5-carboxylate.
| Compound Name | (3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-(4-nonylphenyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22913215 |
| Molecular Formula | C25H33F3N2O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (3-ethoxy-1,1,1-trifluoropropan-2-yl) 2-(4-nonylphenyl)pyrimidine-5-carboxylate |
| SMILES | CCCCCCCCCc1ccc(-c2ncc(C(=O)OC(COCC)C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C25H33F3N2O3/c1-3-5-6-7-8-9-10-11-19-12-14-20(15-13-19)23-29-16-21(17-30-23)24(31)33-22(18-32-4-2)25(26,27)28/h12-17,22H,3-11,18H2,1-2H3 |
| InChIKey | RWBKKVGZIDRGMZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|