C32H41FN2O2 — CID 54114202
[(2S)-2-fluorooctyl] 4-[5-[2-(4-pentylphenyl)ethyl]pyrimidin-2-yl]benzoate (PubChem CID 54114202) has the molecular formula C32H41FN2O2 and a molecular weight of 504.69 g/mol. Its IUPAC name is [(2S)-2-fluorooctyl] 4-[5-[2-(4-pentylphenyl)ethyl]pyrimidin-2-yl]benzoate.
| Compound Name | [(2S)-2-fluorooctyl] 4-[5-[2-(4-pentylphenyl)ethyl]pyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 54114202 |
| Molecular Formula | C32H41FN2O2 |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | [(2S)-2-fluorooctyl] 4-[5-[2-(4-pentylphenyl)ethyl]pyrimidin-2-yl]benzoate |
| SMILES | CCCCCC[C@H](F)COC(=O)c1ccc(-c2ncc(CCc3ccc(CCCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C32H41FN2O2/c1-3-5-7-9-11-30(33)24-37-32(36)29-20-18-28(19-21-29)31-34-22-27(23-35-31)17-16-26-14-12-25(13-15-26)10-8-6-4-2/h12-15,18-23,30H,3-11,16-17,24H2,1-2H3/t30-/m0/s1 |
| InChIKey | NJEXMNBDJZAWKQ-PMERELPUSA-N |
| XLogP | 8.13 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|