C24H29F3O3 — CID 22913306
(1,1,1-trifluoro-3-methoxypropan-2-yl) 4-(4-heptylphenyl)benzoate (PubChem CID 22913306) has the molecular formula C24H29F3O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-methoxypropan-2-yl) 4-(4-heptylphenyl)benzoate.
| Compound Name | (1,1,1-trifluoro-3-methoxypropan-2-yl) 4-(4-heptylphenyl)benzoate |
|---|---|
| PubChem CID | 22913306 |
| Molecular Formula | C24H29F3O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (1,1,1-trifluoro-3-methoxypropan-2-yl) 4-(4-heptylphenyl)benzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)OC(COC)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H29F3O3/c1-3-4-5-6-7-8-18-9-11-19(12-10-18)20-13-15-21(16-14-20)23(28)30-22(17-29-2)24(25,26)27/h9-16,22H,3-8,17H2,1-2H3 |
| InChIKey | UTLDZRAHBFBUIA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|