C39H60O4 — CID 140712309
[5,5-diethyl-6-(4-hexylbenzoyl)oxynonan-4-yl] 4-hexylbenzoate (PubChem CID 140712309) has the molecular formula C39H60O4 and a molecular weight of 592.91 g/mol. Its IUPAC name is [5,5-diethyl-6-(4-hexylbenzoyl)oxynonan-4-yl] 4-hexylbenzoate.
| Compound Name | [5,5-diethyl-6-(4-hexylbenzoyl)oxynonan-4-yl] 4-hexylbenzoate |
|---|---|
| PubChem CID | 140712309 |
| Molecular Formula | C39H60O4 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 592.45 |
| IUPAC Name | [5,5-diethyl-6-(4-hexylbenzoyl)oxynonan-4-yl] 4-hexylbenzoate |
| SMILES | CCCCCCc1ccc(C(=O)OC(CCC)C(CC)(CC)C(CCC)OC(=O)c2ccc(CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C39H60O4/c1-7-13-15-17-21-31-23-27-33(28-24-31)37(40)42-35(19-9-3)39(11-5,12-6)36(20-10-4)43-38(41)34-29-25-32(26-30-34)22-18-16-14-8-2/h23-30,35-36H,7-22H2,1-6H3 |
| InChIKey | VIELRABUTZPBTH-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|