C24H23F3N2O3 — CID 139806896
1,1,1-trifluoroheptan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate (PubChem CID 139806896) has the molecular formula C24H23F3N2O3 and a molecular weight of 444.45 g/mol. Its IUPAC name is 1,1,1-trifluoroheptan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate.
| Compound Name | 1,1,1-trifluoroheptan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 139806896 |
| Molecular Formula | C24H23F3N2O3 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1,1,1-trifluoroheptan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate |
| SMILES | CCCCCC(OC(=O)c1ccc(-c2ncc(-c3ccccc3O)cn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H23F3N2O3/c1-2-3-4-9-21(24(25,26)27)32-23(31)17-12-10-16(11-13-17)22-28-14-18(15-29-22)19-7-5-6-8-20(19)30/h5-8,10-15,21,30H,2-4,9H2,1H3 |
| InChIKey | YQRIXXDHGRWFMI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|