C22H19F3N2O3 — CID 139806888
1,1,1-trifluoropentan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate (PubChem CID 139806888) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 1,1,1-trifluoropentan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate.
| Compound Name | 1,1,1-trifluoropentan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 139806888 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1,1,1-trifluoropentan-2-yl 4-[5-(2-hydroxyphenyl)pyrimidin-2-yl]benzoate |
| SMILES | CCCC(OC(=O)c1ccc(-c2ncc(-c3ccccc3O)cn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H19F3N2O3/c1-2-5-19(22(23,24)25)30-21(29)15-10-8-14(9-11-15)20-26-12-16(13-27-20)17-6-3-4-7-18(17)28/h3-4,6-13,19,28H,2,5H2,1H3 |
| InChIKey | DIBJIELVDOUKDW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |