C22H22ClF3O3 — CID 54127613
1,1,1-trifluorooctan-2-yl 4-(4-carbonochloridoylphenyl)benzoate (PubChem CID 54127613) has the molecular formula C22H22ClF3O3 and a molecular weight of 426.86 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 4-(4-carbonochloridoylphenyl)benzoate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 4-(4-carbonochloridoylphenyl)benzoate |
|---|---|
| PubChem CID | 54127613 |
| Molecular Formula | C22H22ClF3O3 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 4-(4-carbonochloridoylphenyl)benzoate |
| SMILES | CCCCCCC(OC(=O)c1ccc(-c2ccc(C(=O)Cl)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H22ClF3O3/c1-2-3-4-5-6-19(22(24,25)26)29-21(28)18-13-9-16(10-14-18)15-7-11-17(12-8-15)20(23)27/h7-14,19H,2-6H2,1H3 |
| InChIKey | NSCATAXNJNVJBB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|