C36H43F3O5 — CID 19918864
1,1,1-trifluorooctan-2-yl 4-(5-octylperoxycarbonyl-2-phenylphenyl)benzoate (PubChem CID 19918864) has the molecular formula C36H43F3O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 4-(5-octylperoxycarbonyl-2-phenylphenyl)benzoate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 4-(5-octylperoxycarbonyl-2-phenylphenyl)benzoate |
|---|---|
| PubChem CID | 19918864 |
| Molecular Formula | C36H43F3O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 4-(5-octylperoxycarbonyl-2-phenylphenyl)benzoate |
| SMILES | CCCCCCCCOOC(=O)c1ccc(-c2ccccc2)c(-c2ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C36H43F3O5/c1-3-5-7-9-10-15-25-42-44-35(41)30-23-24-31(27-16-12-11-13-17-27)32(26-30)28-19-21-29(22-20-28)34(40)43-33(36(37,38)39)18-14-8-6-4-2/h11-13,16-17,19-24,26,33H,3-10,14-15,18,25H2,1-2H3 |
| InChIKey | WDJWIIVAWRRUHX-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|