C32H40O3 — CID 54473439
pentan-2-yl 4-(4-octoxyphenyl)-3-phenylbenzoate (PubChem CID 54473439) has the molecular formula C32H40O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is pentan-2-yl 4-(4-octoxyphenyl)-3-phenylbenzoate.
| Compound Name | pentan-2-yl 4-(4-octoxyphenyl)-3-phenylbenzoate |
|---|---|
| PubChem CID | 54473439 |
| Molecular Formula | C32H40O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | pentan-2-yl 4-(4-octoxyphenyl)-3-phenylbenzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)OC(C)CCC)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H40O3/c1-4-6-7-8-9-13-23-34-29-20-17-27(18-21-29)30-22-19-28(32(33)35-25(3)14-5-2)24-31(30)26-15-11-10-12-16-26/h10-12,15-22,24-25H,4-9,13-14,23H2,1-3H3 |
| InChIKey | XJWXBRDRNYIRCJ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|