C37H48O6 — CID 18646103
3-[4-[(2S)-2-heptanoyloxypropoxy]phenyl]-4-(4-octoxyphenyl)benzoic acid (PubChem CID 18646103) has the molecular formula C37H48O6 and a molecular weight of 588.79 g/mol. Its IUPAC name is 3-[4-[(2S)-2-heptanoyloxypropoxy]phenyl]-4-(4-octoxyphenyl)benzoic acid.
| Compound Name | 3-[4-[(2S)-2-heptanoyloxypropoxy]phenyl]-4-(4-octoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 18646103 |
| Molecular Formula | C37H48O6 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | 3-[4-[(2S)-2-heptanoyloxypropoxy]phenyl]-4-(4-octoxyphenyl)benzoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)O)cc2-c2ccc(OC[C@H](C)OC(=O)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C37H48O6/c1-4-6-8-10-11-13-25-41-32-20-15-29(16-21-32)34-24-19-31(37(39)40)26-35(34)30-17-22-33(23-18-30)42-27-28(3)43-36(38)14-12-9-7-5-2/h15-24,26,28H,4-14,25,27H2,1-3H3,(H,39,40)/t28-/m0/s1 |
| InChIKey | DJMMRFOXTJYCNV-NDEPHWFRSA-N |
| XLogP | 9.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|