C30H36O3 — CID 70366354
4-[2-(4-hexoxyphenyl)-4-(2-methylbutyl)phenyl]benzoic acid (PubChem CID 70366354) has the molecular formula C30H36O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is 4-[2-(4-hexoxyphenyl)-4-(2-methylbutyl)phenyl]benzoic acid.
| Compound Name | 4-[2-(4-hexoxyphenyl)-4-(2-methylbutyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 70366354 |
| Molecular Formula | C30H36O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 4-[2-(4-hexoxyphenyl)-4-(2-methylbutyl)phenyl]benzoic acid |
| SMILES | CCCCCCOc1ccc(-c2cc(CC(C)CC)ccc2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H36O3/c1-4-6-7-8-19-33-27-16-14-25(15-17-27)29-21-23(20-22(3)5-2)9-18-28(29)24-10-12-26(13-11-24)30(31)32/h9-18,21-22H,4-8,19-20H2,1-3H3,(H,31,32) |
| InChIKey | LKCUWQWACHWHFG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|