About (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate
(4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate (PubChem CID 54275481) has the molecular formula C35H44O5
and a molecular weight of 544.73 g/mol. Its IUPAC name is (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate.
Molecular Properties
| Compound Name | (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate |
| PubChem CID | 54275481 |
| Molecular Formula | C35H44O5 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)OOC(=O)c2ccc(-c3ccccc3)c(CC(C)CC)c2)cc1 |
| InChI | InChI=1S/C35H44O5/c1-4-6-7-8-9-10-11-15-24-38-32-21-18-29(19-22-32)34(36)39-40-35(37)30-20-23-33(28-16-13-12-14-17-28)31(26-30)25-27(3)5-2/h12-14,16-23,26-27H,4-11,15,24-25H2,1-3H3 |
| InChIKey | RNCNOIOLRJBRDB-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate?
The IUPAC name of (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate (CID 54275481) is (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate.
What is the SMILES notation for (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate?
The canonical SMILES for (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate is CCCCCCCCCCOc1ccc(C(=O)OOC(=O)c2ccc(-c3ccccc3)c(CC(C)CC)c2)cc1.
What is the InChIKey of (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate?
The InChIKey is RNCNOIOLRJBRDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H44O5/c1-4-6-7-8-9-10-11-15-24-38-32-21-18-29(19-22-32)34(36)39-40-35(37)30-20-23-33(28-16-13-12-14-17-28)31(26-30)25-27(3)5-2/h12-14,16-23,26-27H,4-11,15,24-25H2,1-3H3.
What are the key properties of (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate?
(4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate has a molecular weight of 544.73 g/mol, XLogP of 9.39, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-decoxybenzoyl) 3-(2-methylbutyl)-4-phenylbenzenecarboperoxoate is sourced from PubChem (CID 54275481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).