C35H46O3 — CID 139694210
1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl hexanoate (PubChem CID 139694210) has the molecular formula C35H46O3 and a molecular weight of 514.75 g/mol. Its IUPAC name is 1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl hexanoate.
| Compound Name | 1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl hexanoate |
|---|---|
| PubChem CID | 139694210 |
| Molecular Formula | C35H46O3 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | 1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl hexanoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccccc2-c2ccc(C(C)OC(=O)CCCCC)cc2)cc1 |
| InChI | InChI=1S/C35H46O3/c1-4-6-8-9-10-11-15-27-37-32-25-23-31(24-26-32)34-17-14-13-16-33(34)30-21-19-29(20-22-30)28(3)38-35(36)18-12-7-5-2/h13-14,16-17,19-26,28H,4-12,15,18,27H2,1-3H3 |
| InChIKey | LSLJZGDNVFALQX-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|