C33H42O3 — CID 139693943
1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl butanoate (PubChem CID 139693943) has the molecular formula C33H42O3 and a molecular weight of 486.70 g/mol. Its IUPAC name is 1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl butanoate.
| Compound Name | 1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl butanoate |
|---|---|
| PubChem CID | 139693943 |
| Molecular Formula | C33H42O3 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | 1-[4-[2-(4-nonoxyphenyl)phenyl]phenyl]ethyl butanoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccccc2-c2ccc(C(C)OC(=O)CCC)cc2)cc1 |
| InChI | InChI=1S/C33H42O3/c1-4-6-7-8-9-10-13-25-35-30-23-21-29(22-24-30)32-16-12-11-15-31(32)28-19-17-27(18-20-28)26(3)36-33(34)14-5-2/h11-12,15-24,26H,4-10,13-14,25H2,1-3H3 |
| InChIKey | IULWAFUBVRQIIH-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|