C36H48O3 — CID 139693494
1-[4-[2-(4-hexoxyphenyl)phenyl]phenyl]ethyl decanoate (PubChem CID 139693494) has the molecular formula C36H48O3 and a molecular weight of 528.78 g/mol. Its IUPAC name is 1-[4-[2-(4-hexoxyphenyl)phenyl]phenyl]ethyl decanoate.
| Compound Name | 1-[4-[2-(4-hexoxyphenyl)phenyl]phenyl]ethyl decanoate |
|---|---|
| PubChem CID | 139693494 |
| Molecular Formula | C36H48O3 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | 1-[4-[2-(4-hexoxyphenyl)phenyl]phenyl]ethyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC(C)c1ccc(-c2ccccc2-c2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C36H48O3/c1-4-6-8-10-11-12-13-19-36(37)39-29(3)30-20-22-31(23-21-30)34-17-14-15-18-35(34)32-24-26-33(27-25-32)38-28-16-9-7-5-2/h14-15,17-18,20-27,29H,4-13,16,19,28H2,1-3H3 |
| InChIKey | SCWYVPCGRUCGFL-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|