C38H45F4O5- — CID 154297273
4-(4-decoxy-3-fluorophenyl)-3-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoate (PubChem CID 154297273) has the molecular formula C38H45F4O5- and a molecular weight of 657.77 g/mol. Its IUPAC name is 4-(4-decoxy-3-fluorophenyl)-3-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoate.
| Compound Name | 4-(4-decoxy-3-fluorophenyl)-3-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoate |
|---|---|
| PubChem CID | 154297273 |
| Molecular Formula | C38H45F4O5- |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | 4-(4-decoxy-3-fluorophenyl)-3-[4-(1,1,1-trifluorooctan-2-yloxycarbonyl)phenyl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)[O-])cc2-c2ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C38H46F4O5/c1-3-5-7-9-10-11-12-14-24-46-34-23-21-29(26-33(34)39)31-22-20-30(36(43)44)25-32(31)27-16-18-28(19-17-27)37(45)47-35(38(40,41)42)15-13-8-6-4-2/h16-23,25-26,35H,3-15,24H2,1-2H3,(H,43,44)/p-1 |
| InChIKey | AFOUWAJSGVHVPQ-UHFFFAOYSA-M |
| XLogP | 10.10 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|