C34H43FN2O3 — CID 139745365
[(2S)-octan-2-yl] 4-[4-[(3-fluoro-4-heptoxyphenyl)diazenyl]phenyl]benzoate (PubChem CID 139745365) has the molecular formula C34H43FN2O3 and a molecular weight of 546.73 g/mol. Its IUPAC name is [(2S)-octan-2-yl] 4-[4-[(3-fluoro-4-heptoxyphenyl)diazenyl]phenyl]benzoate.
| Compound Name | [(2S)-octan-2-yl] 4-[4-[(3-fluoro-4-heptoxyphenyl)diazenyl]phenyl]benzoate |
|---|---|
| PubChem CID | 139745365 |
| Molecular Formula | C34H43FN2O3 |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | [(2S)-octan-2-yl] 4-[4-[(3-fluoro-4-heptoxyphenyl)diazenyl]phenyl]benzoate |
| SMILES | CCCCCCCOc1ccc(/N=N/c2ccc(-c3ccc(C(=O)O[C@@H](C)CCCCCC)cc3)cc2)cc1F |
| InChI | InChI=1S/C34H43FN2O3/c1-4-6-8-10-12-24-39-33-23-22-31(25-32(33)35)37-36-30-20-18-28(19-21-30)27-14-16-29(17-15-27)34(38)40-26(3)13-11-9-7-5-2/h14-23,25-26H,4-13,24H2,1-3H3/b37-36+/t26-/m0/s1 |
| InChIKey | RKPMJSQXJFEONH-LNMKRNKHSA-N |
| XLogP | 10.77 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|